CAS 1095568-30-1 appears in our catalog under these names: 7-Chloro-2-(4-(chloromethyl)phenyl)-1,3-benzothiazole, 95%, 7-Chloro-2-(4-(chloromethyl)phenyl)-1,3-benzothiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-chloro-2-[4-(chloromethyl)phenyl]-1,3-benzothiazole (CAS 1095568-30-1) is a chemical compound with the molecular formula C14H9Cl2NS and a molecular weight of 294.2 g/mol. IUPAC name: 7-chloro-2-[4-(chloromethyl)phenyl]-1,3-benzothiazole. InChIKey: ILEOBPMTKVNAOM-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2NS |
|---|---|
| Molecular weight | 294.2 g/mol |
| IUPAC name | 7-chloro-2-[4-(chloromethyl)phenyl]-1,3-benzothiazole |
| InChIKey | ILEOBPMTKVNAOM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)SC(=N2)C3=CC=C(C=C3)CCl |
Computed by PubChem (NCBI)