CAS 1096267-76-3 is the registry number for 5-Chloro-2-(4-(chloromethyl)phenyl)-1,3-benzothiazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-chloro-2-[4-(chloromethyl)phenyl]-1,3-benzothiazole (CAS 1096267-76-3) is a chemical compound with the molecular formula C14H9Cl2NS and a molecular weight of 294.2 g/mol. IUPAC name: 5-chloro-2-[4-(chloromethyl)phenyl]-1,3-benzothiazole. InChIKey: CRORNCCSKFCPNG-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2NS |
|---|---|
| Molecular weight | 294.2 g/mol |
| IUPAC name | 5-chloro-2-[4-(chloromethyl)phenyl]-1,3-benzothiazole |
| InChIKey | CRORNCCSKFCPNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCl)C2=NC3=C(S2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)