CAS 1095823-37-2 appears in our catalog under these names: 2-[1-(Cbz-amino)methyl]-5-thiazolecarboxylic acid, 95%, 2-((((Benzyloxy)carbonyl)amino)methyl)thiazole-5-carboxylic acid, 98%, 2-[1-(Cbz-amino)methyl]-5-thiazolecarboxylic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg.
2-(phenylmethoxycarbonylaminomethyl)-1,3-thiazole-5-carboxylic acid (CAS 1095823-37-2) is a chemical compound with the molecular formula C13H12N2O4S and a molecular weight of 292.31 g/mol. IUPAC name: 2-(phenylmethoxycarbonylaminomethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: SCGGRPVGUJMOLY-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4S |
|---|---|
| Molecular weight | 292.31 g/mol |
| IUPAC name | 2-(phenylmethoxycarbonylaminomethyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | SCGGRPVGUJMOLY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)