CAS 429649-34-3 is the registry number for 1-(3,4-Dihydroxyphenyl)-2-[(4-hydroxy-6-methylpyrimidin-2-yl)thio]ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-4-methyl-1H-pyrimidin-6-one (CAS 429649-34-3) is a chemical compound with the molecular formula C13H12N2O4S and a molecular weight of 292.31 g/mol. IUPAC name: 2-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-4-methyl-1H-pyrimidin-6-one. InChIKey: GYSSMOSVLZXNJL-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4S |
|---|---|
| Molecular weight | 292.31 g/mol |
| IUPAC name | 2-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-4-methyl-1H-pyrimidin-6-one |
| InChIKey | GYSSMOSVLZXNJL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC(=N1)SCC(=O)C2=CC(=C(C=C2)O)O |
Computed by PubChem (NCBI)