Products 1096260-70-6
CAS 1096260-70-6 is the registry number for 4-(N-Methyl-N-(tetrahydrothiophen-3-yl)sulfamoyl)-1H-pyrrole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[methyl(thiolan-3-yl)sulfamoyl]-1H-pyrrole-2-carboxylic acid (CAS 1096260-70-6) is a chemical compound with the molecular formula C10H14N2O4S2 and a molecular weight of 290.4 g/mol. IUPAC name: 4-[methyl(thiolan-3-yl)sulfamoyl]-1H-pyrrole-2-carboxylic acid. InChIKey: SSYZCZQNJYKRKX-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4S2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 4-[methyl(thiolan-3-yl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
| InChIKey | SSYZCZQNJYKRKX-UHFFFAOYSA-N |
| SMILES | CN(C1CCSC1)S(=O)(=O)C2=CNC(=C2)C(=O)O |
Computed by PubChem (NCBI)