Products 1795021-05-4
CAS 1795021-05-4 appears in our catalog under these names: Sulthiame-d4, Sulthiame-d4, >95% (HPLC). Offered by: Chemat Brand, TRC, TargetMol, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 1 mg, 10 mg.
2,3,5,6-tetradeuterio-4-(1,1-dioxothiazinan-2-yl)benzenesulfonamide (CAS 1795021-05-4) is a chemical compound with the molecular formula C10H14N2O4S2 and a molecular weight of 294.4 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(1,1-dioxothiazinan-2-yl)benzenesulfonamide. InChIKey: HMHVCUVYZFYAJI-LNFUJOGGSA-N.
| Molecular formula | C10H14N2O4S2 |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-(1,1-dioxothiazinan-2-yl)benzenesulfonamide |
| InChIKey | HMHVCUVYZFYAJI-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N2CCCCS2(=O)=O)[2H])[2H])S(=O)(=O)N)[2H] |
Computed by PubChem (NCBI)