CAS 109628-38-8 is the registry number for (2-(β-Piperidinoethyl)-9-hydroxyellipticinium chloride. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,11-dimethyl-2-(2-piperidin-1-ylethyl)-6H-pyrido[4,3-b]carbazol-2-ium-9-ol chloride (CAS 109628-38-8) is a chemical compound with the molecular formula C24H28ClN3O and a molecular weight of 409.9 g/mol. IUPAC name: 5,11-dimethyl-2-(2-piperidin-1-ylethyl)-6H-pyrido[4,3-b]carbazol-2-ium-9-ol chloride. InChIKey: QQRBMQWRQMDNAN-UHFFFAOYSA-N.
| Molecular formula | C24H28ClN3O |
|---|---|
| Molecular weight | 409.9 g/mol |
| IUPAC name | 5,11-dimethyl-2-(2-piperidin-1-ylethyl)-6H-pyrido[4,3-b]carbazol-2-ium-9-ol chloride |
| InChIKey | QQRBMQWRQMDNAN-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C[N+](=CC2=C(C3=C1NC4=C3C=C(C=C4)O)C)CCN5CCCCC5.[Cl-] |
Computed by PubChem (NCBI)