Products 1096822-75-1
CAS 1096822-75-1 is the registry number for 6-Chloro-n-(cyclohexylmethyl)pyridine-3-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-chloro-N-(cyclohexylmethyl)pyridine-3-sulfonamide (CAS 1096822-75-1) is a chemical compound with the molecular formula C12H17ClN2O2S and a molecular weight of 288.79 g/mol. IUPAC name: 6-chloro-N-(cyclohexylmethyl)pyridine-3-sulfonamide. InChIKey: SHBHGNYWKZTYLI-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O2S |
|---|---|
| Molecular weight | 288.79 g/mol |
| IUPAC name | 6-chloro-N-(cyclohexylmethyl)pyridine-3-sulfonamide |
| InChIKey | SHBHGNYWKZTYLI-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)CNS(=O)(=O)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)