CAS 2306265-51-8 is the registry number for tert-Butyl 2-(chloromethyl)-6,7-dihydro-4h-thiazolo[5,4-c]pyridine-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 2-(chloromethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate (CAS 2306265-51-8) is a chemical compound with the molecular formula C12H17ClN2O2S and a molecular weight of 288.79 g/mol. IUPAC name: tert-butyl 2-(chloromethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate. InChIKey: VPSJJZSYMQJKEQ-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O2S |
|---|---|
| Molecular weight | 288.79 g/mol |
| IUPAC name | tert-butyl 2-(chloromethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate |
| InChIKey | VPSJJZSYMQJKEQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)SC(=N2)CCl |
Computed by PubChem (NCBI)