CAS 1097046-53-1 appears in our catalog under these names: 2-(1,1-Dioxidotetrahydrothiophen-3-yl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 2-(1,1-Dioxo-1-thiolan-3-yl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 100mg, 1g.
2-(1,1-dioxothiolan-3-yl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 1097046-53-1) is a chemical compound with the molecular formula C13H11NO6S and a molecular weight of 309.30 g/mol. IUPAC name: 2-(1,1-dioxothiolan-3-yl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: IABZZPAAVQPBGD-UHFFFAOYSA-N.
| Molecular formula | C13H11NO6S |
|---|---|
| Molecular weight | 309.30 g/mol |
| IUPAC name | 2-(1,1-dioxothiolan-3-yl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | IABZZPAAVQPBGD-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)