CAS 343934-41-8 appears in our catalog under these names: 4-(Ethenylsulfonyl)benzoic Acid 2,5-Dioxo-1-pyrrolidinyl Ester, 2,5-Dioxopyrrolidin-1-yl 4-(vinylsulfonyl)benzoate, 98%, 98%. Offered by: TRC, Biosynth, Chemat. Available pack sizes: 1g, 25mg, 10mg, 50mg.
(2,5-dioxopyrrolidin-1-yl) 4-ethenylsulfonylbenzoate (CAS 343934-41-8) is a chemical compound with the molecular formula C13H11NO6S and a molecular weight of 309.30 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-ethenylsulfonylbenzoate. InChIKey: RNEGCBKQENAPPA-UHFFFAOYSA-N.
| Molecular formula | C13H11NO6S |
|---|---|
| Molecular weight | 309.30 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 4-ethenylsulfonylbenzoate |
| InChIKey | RNEGCBKQENAPPA-UHFFFAOYSA-N |
| SMILES | C=CS(=O)(=O)C1=CC=C(C=C1)C(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)