Products 1097064-73-7
CAS 1097064-73-7 is the registry number for 1-(1,1-Dioxidotetrahydrothiophen-3-yl)-6-methyl-1,7-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1-dioxothiolan-3-yl)-6-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 1097064-73-7) is a chemical compound with the molecular formula C10H12N4O3S and a molecular weight of 268.29 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)-6-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: VHZMCYKVKLSOAS-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O3S |
|---|---|
| Molecular weight | 268.29 g/mol |
| IUPAC name | 1-(1,1-dioxothiolan-3-yl)-6-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | VHZMCYKVKLSOAS-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=NN2C3CCS(=O)(=O)C3)C(=O)N1 |
Computed by PubChem (NCBI)