CAS 1291836-94-6 is the registry number for 6-(Pyrrolidin-1-ylsulfonyl)[1,2,4]triazolo[4,3-a]pyridin-3(2h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
6-pyrrolidin-1-ylsulfonyl-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one (CAS 1291836-94-6) is a chemical compound with the molecular formula C10H12N4O3S and a molecular weight of 268.29 g/mol. IUPAC name: 6-pyrrolidin-1-ylsulfonyl-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one. InChIKey: QYSQLZDMTVUFKU-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O3S |
|---|---|
| Molecular weight | 268.29 g/mol |
| IUPAC name | 6-pyrrolidin-1-ylsulfonyl-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| InChIKey | QYSQLZDMTVUFKU-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CN3C(=NNC3=O)C=C2 |
Computed by PubChem (NCBI)