Products 1147757-61-6
CAS 1147757-61-6 is the registry number for N-(4-(3-Oxopiperazine-1-carbonyl)thiazol-2-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-(3-oxopiperazine-1-carbonyl)-1,3-thiazol-2-yl]acetamide (CAS 1147757-61-6) is a chemical compound with the molecular formula C10H12N4O3S and a molecular weight of 268.29 g/mol. IUPAC name: N-[4-(3-oxopiperazine-1-carbonyl)-1,3-thiazol-2-yl]acetamide. InChIKey: AOLFNTLVWRDEDI-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O3S |
|---|---|
| Molecular weight | 268.29 g/mol |
| IUPAC name | N-[4-(3-oxopiperazine-1-carbonyl)-1,3-thiazol-2-yl]acetamide |
| InChIKey | AOLFNTLVWRDEDI-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC(=CS1)C(=O)N2CCNC(=O)C2 |
Computed by PubChem (NCBI)