CAS 1097192-04-5 appears in our catalog under these names: Fmoc-L-delta-azidoornithine, 97%, Fmoc–δ–azido–Nva–OH, Fmoc-L-Orn(N3)-OH, Fmoc-Orn(N3)-OH, (S)-5-Azido-2-(Fmoc-amino)pentanoic acid , 98.50%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Chemat. Available pack sizes: 25g, 1g, 5g, 250mg, 100g, 500mg, 0,1g, 0,25g.
(2S)-5-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 1097192-04-5) is a chemical compound with the molecular formula C20H20N4O4 and a molecular weight of 380.4 g/mol. IUPAC name: (2S)-5-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: TVPIDQLSARDIPX-SFHVURJKSA-N.
| Molecular formula | C20H20N4O4 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | (2S)-5-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | TVPIDQLSARDIPX-SFHVURJKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)