CAS 1176270-25-9 appears in our catalog under these names: Fmoc–D–Orn(N3)–OH, Fmoc-D-Orn(N3)-OH, Fmoc-D-Orn(N3), (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-azidopentanoic acid, ≥95%, ≥95%. Offered by: GLPBio, Iris Biotech, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 50mg, 5g, 25g, 500mg, 1000mg.
(2R)-5-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 1176270-25-9) is a chemical compound with the molecular formula C20H20N4O4 and a molecular weight of 380.4 g/mol. IUPAC name: (2R)-5-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: TVPIDQLSARDIPX-GOSISDBHSA-N.
| Molecular formula | C20H20N4O4 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | (2R)-5-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | TVPIDQLSARDIPX-GOSISDBHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)