CAS 109722-47-6 is the registry number for 2-Phenyl-benzo[4,5]imidazo[1,2-a]pyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
2-phenylpyrimido[1,2-a]benzimidazole (CAS 109722-47-6) is a chemical compound with the molecular formula C16H11N3 and a molecular weight of 245.28 g/mol. IUPAC name: 2-phenylpyrimido[1,2-a]benzimidazole. InChIKey: BJBCCFJQRLRHDR-UHFFFAOYSA-N.
| Molecular formula | C16H11N3 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | 2-phenylpyrimido[1,2-a]benzimidazole |
| InChIKey | BJBCCFJQRLRHDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=NC4=CC=CC=C4N3C=C2 |
Computed by PubChem (NCBI)