CAS 1097429-88-3 is the registry number for 4,5-Dibromo-N-(prop-2-yn-1-yl)thiophene-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dibromo-N-prop-2-ynylthiophene-2-carboxamide (CAS 1097429-88-3) is a chemical compound with the molecular formula C8H5Br2NOS and a molecular weight of 323.01 g/mol. IUPAC name: 4,5-dibromo-N-prop-2-ynylthiophene-2-carboxamide. InChIKey: KFTJJUSUQMFFQZ-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2NOS |
|---|---|
| Molecular weight | 323.01 g/mol |
| IUPAC name | 4,5-dibromo-N-prop-2-ynylthiophene-2-carboxamide |
| InChIKey | KFTJJUSUQMFFQZ-UHFFFAOYSA-N |
| SMILES | C#CCNC(=O)C1=CC(=C(S1)Br)Br |
Computed by PubChem (NCBI)