CAS 354760-28-4 is the registry number for 2,7-Dibromo-4-methoxybenzo[d]thiazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,7-dibromo-4-methoxy-1,3-benzothiazole (CAS 354760-28-4) is a chemical compound with the molecular formula C8H5Br2NOS and a molecular weight of 323.01 g/mol. IUPAC name: 2,7-dibromo-4-methoxy-1,3-benzothiazole. InChIKey: OPZMIAAAAYCZJC-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2NOS |
|---|---|
| Molecular weight | 323.01 g/mol |
| IUPAC name | 2,7-dibromo-4-methoxy-1,3-benzothiazole |
| InChIKey | OPZMIAAAAYCZJC-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)Br)SC(=N2)Br |
Computed by PubChem (NCBI)