CAS 1097789-53-1 appears in our catalog under these names: 1-((4-Chloro-3-nitrophenyl)methyl)-1,2,3,4-tetrahydropyrimidine-2,4-dione, 98%, 1-((4-Chloro-3-nitrophenyl)methyl)-1,2,3,4-tetrahydropyrimidine-2,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-[(4-chloro-3-nitrophenyl)methyl]pyrimidine-2,4-dione (CAS 1097789-53-1) is a chemical compound with the molecular formula C11H8ClN3O4 and a molecular weight of 281.65 g/mol. IUPAC name: 1-[(4-chloro-3-nitrophenyl)methyl]pyrimidine-2,4-dione. InChIKey: PIJQFTGOWJWBBU-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN3O4 |
|---|---|
| Molecular weight | 281.65 g/mol |
| IUPAC name | 1-[(4-chloro-3-nitrophenyl)methyl]pyrimidine-2,4-dione |
| InChIKey | PIJQFTGOWJWBBU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN2C=CC(=O)NC2=O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)