CAS 312601-70-0 is the registry number for 4-((4-Chloro-3-nitro-1H-pyrazol-1-yl)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
4-[(4-chloro-3-nitropyrazol-1-yl)methyl]benzoic acid (CAS 312601-70-0) is a chemical compound with the molecular formula C11H8ClN3O4 and a molecular weight of 281.65 g/mol. IUPAC name: 4-[(4-chloro-3-nitropyrazol-1-yl)methyl]benzoic acid. InChIKey: NDPOIGJDZZNZNU-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN3O4 |
|---|---|
| Molecular weight | 281.65 g/mol |
| IUPAC name | 4-[(4-chloro-3-nitropyrazol-1-yl)methyl]benzoic acid |
| InChIKey | NDPOIGJDZZNZNU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=C(C(=N2)[N+](=O)[O-])Cl)C(=O)O |
Computed by PubChem (NCBI)