Products 312601-70-0

CAS 312601-70-0 is the registry number for 4-((4-Chloro-3-nitro-1H-pyrazol-1-yl)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

4-[(4-chloro-3-nitropyrazol-1-yl)methyl]benzoic acid (CAS 312601-70-0) is a chemical compound with the molecular formula C11H8ClN3O4 and a molecular weight of 281.65 g/mol. IUPAC name: 4-[(4-chloro-3-nitropyrazol-1-yl)methyl]benzoic acid. InChIKey: NDPOIGJDZZNZNU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8ClN3O4
Molecular weight281.65 g/mol
IUPAC name4-[(4-chloro-3-nitropyrazol-1-yl)methyl]benzoic acid
InChIKeyNDPOIGJDZZNZNU-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CN2C=C(C(=N2)[N+](=O)[O-])Cl)C(=O)O

Computed by PubChem (NCBI)