Products 1097793-12-8
CAS 1097793-12-8 appears in our catalog under these names: 2-(tert-Butoxy)-5-methylaniline, 95%, 2-(tert-Butoxy)-5-methylaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
5-methyl-2-[(2-methylpropan-2-yl)oxy]aniline (CAS 1097793-12-8) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. IUPAC name: 5-methyl-2-[(2-methylpropan-2-yl)oxy]aniline. InChIKey: UHEQBNWNYUHZKI-UHFFFAOYSA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | 5-methyl-2-[(2-methylpropan-2-yl)oxy]aniline |
| InChIKey | UHEQBNWNYUHZKI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC(C)(C)C)N |
Computed by PubChem (NCBI)