CAS 1097834-88-2 appears in our catalog under these names: 1-tert-Butyl 2-methyl 3-bromo-1h-pyrrole-1,2-dicarboxylate, 95%, 1-tert-Butyl 2-methyl 3-bromo-1H-pyrrole-1,2-dicarboxylate, 95%, 95%, 1-tert-Butyl 2-methyl 3-bromo-1H-pyrrole-1,2-dicarboxylate, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 500mg, 25g.
1-O-tert-butyl 2-O-methyl 3-bromopyrrole-1,2-dicarboxylate (CAS 1097834-88-2) is a chemical compound with the molecular formula C11H14BrNO4 and a molecular weight of 304.14 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 3-bromopyrrole-1,2-dicarboxylate. InChIKey: LLWNJLSKYPDNOF-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO4 |
|---|---|
| Molecular weight | 304.14 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl 3-bromopyrrole-1,2-dicarboxylate |
| InChIKey | LLWNJLSKYPDNOF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC(=C1C(=O)OC)Br |
Computed by PubChem (NCBI)