CAS 1146081-31-3 is the registry number for 1-tert-Butyl 3-methyl 5-bromo-1H-pyrrole-1,3-dicarboxylate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-O-tert-butyl 3-O-methyl 5-bromopyrrole-1,3-dicarboxylate (CAS 1146081-31-3) is a chemical compound with the molecular formula C11H14BrNO4 and a molecular weight of 304.14 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 5-bromopyrrole-1,3-dicarboxylate. InChIKey: GQRHEAQVGCTKHO-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO4 |
|---|---|
| Molecular weight | 304.14 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 5-bromopyrrole-1,3-dicarboxylate |
| InChIKey | GQRHEAQVGCTKHO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C=C1Br)C(=O)OC |
Computed by PubChem (NCBI)