Products 109789-15-3
CAS 109789-15-3 is the registry number for (+/-)-trans-3-Bromotetrahydro-2-(2-propynyloxy)-furan. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
(2S,3R)-3-bromo-2-prop-2-ynoxyoxolane (CAS 109789-15-3) is a chemical compound with the molecular formula C7H9BrO2 and a molecular weight of 205.05 g/mol. IUPAC name: (2S,3R)-3-bromo-2-prop-2-ynoxyoxolane. InChIKey: AWULWFRVGOGUEH-RNFRBKRXSA-N.
| Molecular formula | C7H9BrO2 |
|---|---|
| Molecular weight | 205.05 g/mol |
| IUPAC name | (2S,3R)-3-bromo-2-prop-2-ynoxyoxolane |
| InChIKey | AWULWFRVGOGUEH-RNFRBKRXSA-N |
| SMILES | C#CCO[C@H]1[C@@H](CCO1)Br |
Computed by PubChem (NCBI)