CAS 139893-81-5 appears in our catalog under these names: Edoxaban Impurity 94, Edoxaban Impurity 80. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(1S,4S,5S)-4-bromo-6-oxabicyclo[3.2.1]octan-7-one (CAS 139893-81-5) is a chemical compound with the molecular formula C7H9BrO2 and a molecular weight of 205.05 g/mol. IUPAC name: (1S,4S,5S)-4-bromo-6-oxabicyclo[3.2.1]octan-7-one. InChIKey: HIEDNXSBEYNHJB-ZLUOBGJFSA-N.
| Molecular formula | C7H9BrO2 |
|---|---|
| Molecular weight | 205.05 g/mol |
| IUPAC name | (1S,4S,5S)-4-bromo-6-oxabicyclo[3.2.1]octan-7-one |
| InChIKey | HIEDNXSBEYNHJB-ZLUOBGJFSA-N |
| SMILES | C1C[C@@H]([C@@H]2C[C@H]1C(=O)O2)Br |
Computed by PubChem (NCBI)