Products 109794-97-0
CAS 109794-97-0 is the registry number for Harmalidine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
5-methoxy-10,10-dimethyl-8,12-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(15),2(7),3,5,11-pentaene (CAS 109794-97-0) is a chemical compound with the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. IUPAC name: 5-methoxy-10,10-dimethyl-8,12-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(15),2(7),3,5,11-pentaene. InChIKey: CTEKBWZEYYSNFV-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O |
|---|---|
| Molecular weight | 254.33 g/mol |
| IUPAC name | 5-methoxy-10,10-dimethyl-8,12-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(15),2(7),3,5,11-pentaene |
| InChIKey | CTEKBWZEYYSNFV-UHFFFAOYSA-N |
| SMILES | CC1(CN2C3=C(C=CC(=C3)OC)C4=C2C1=NCC4)C |
Computed by PubChem (NCBI)