CAS 1098173-30-8 appears in our catalog under these names: 2-Fluoro-6-methylpyridine-3-trifluoroborate potassium salt, 98%, Potassium trifluoro(2-fluoro-6-methylpyridin-3-yl)borate 98%, 2-Fluoro-6-methylpyridine-3-trifluoroborate potassium salt, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg.
Potassium trifluoro-(2-fluoro-6-methyl-3-pyridinyl)boranuide (CAS 1098173-30-8) is a chemical compound with the molecular formula C6H5BF4KN and a molecular weight of 217.02 g/mol. IUPAC name: potassium trifluoro-(2-fluoro-6-methyl-3-pyridinyl)boranuide. InChIKey: CPXSPYVBUBFSAJ-UHFFFAOYSA-N.
| Molecular formula | C6H5BF4KN |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | potassium trifluoro-(2-fluoro-6-methyl-3-pyridinyl)boranuide |
| InChIKey | CPXSPYVBUBFSAJ-UHFFFAOYSA-N |
| SMILES | [B-](C1=C(N=C(C=C1)C)F)(F)(F)F.[K+] |
Computed by PubChem (NCBI)