CAS 2221990-90-3 is the registry number for Potassium 2-(fluoromethyl)pyridine-5-trifluoroborate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Potassium trifluoro-[6-(fluoromethyl)-3-pyridinyl]boranuide (CAS 2221990-90-3) is a chemical compound with the molecular formula C6H5BF4KN and a molecular weight of 217.02 g/mol. IUPAC name: potassium trifluoro-[6-(fluoromethyl)-3-pyridinyl]boranuide. InChIKey: ZDVCLPSTHRERDM-UHFFFAOYSA-N.
| Molecular formula | C6H5BF4KN |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | potassium trifluoro-[6-(fluoromethyl)-3-pyridinyl]boranuide |
| InChIKey | ZDVCLPSTHRERDM-UHFFFAOYSA-N |
| SMILES | [B-](C1=CN=C(C=C1)CF)(F)(F)F.[K+] |
Computed by PubChem (NCBI)