Products 1098268-35-9
CAS 1098268-35-9 appears in our catalog under these names: Farnesol Impurity 7-d6, all-trans-Farnesol-d6 Tetrahydropyranyl Ether. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-[(2E,6E)-12,12,12-trideuterio-3,7-dimethyl-11-(trideuteriomethyl)dodeca-2,6,10-trienoxy]oxane (CAS 1098268-35-9) is a chemical compound with the molecular formula C20H34O2 and a molecular weight of 312.5 g/mol. IUPAC name: 2-[(2E,6E)-12,12,12-trideuterio-3,7-dimethyl-11-(trideuteriomethyl)dodeca-2,6,10-trienoxy]oxane. InChIKey: XPBIICJUTJFRKE-MZOQXPABSA-N.
| Molecular formula | C20H34O2 |
|---|---|
| Molecular weight | 312.5 g/mol |
| IUPAC name | 2-[(2E,6E)-12,12,12-trideuterio-3,7-dimethyl-11-(trideuteriomethyl)dodeca-2,6,10-trienoxy]oxane |
| InChIKey | XPBIICJUTJFRKE-MZOQXPABSA-N |
| SMILES | [2H]C([2H])([2H])C(=CCC/C(=C/CC/C(=C/COC1CCCCO1)/C)/C)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)