Products 1098377-38-8

CAS 1098377-38-8 is the registry number for 2-(4-tert-Butyl-2-methylphenoxy)isonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

2-(4-tert-butyl-2-methylphenoxy)pyridine-4-carboxylic acid (CAS 1098377-38-8) is a chemical compound with the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. IUPAC name: 2-(4-tert-butyl-2-methylphenoxy)pyridine-4-carboxylic acid. InChIKey: MSZOAKXSWODGEY-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO3
Molecular weight285.34 g/mol
IUPAC name2-(4-tert-butyl-2-methylphenoxy)pyridine-4-carboxylic acid
InChIKeyMSZOAKXSWODGEY-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)C(C)(C)C)OC2=NC=CC(=C2)C(=O)O

Computed by PubChem (NCBI)