Products 1098432-96-2
CAS 1098432-96-2 is the registry number for 2-(2,2,6,6-Tetramethyloxan-4-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2,2,6,6-tetramethyloxan-4-yl)acetic acid (CAS 1098432-96-2) is a chemical compound with the molecular formula C11H20O3 and a molecular weight of 200.27 g/mol. IUPAC name: 2-(2,2,6,6-tetramethyloxan-4-yl)acetic acid. InChIKey: OXEUBCJBWRLTDT-UHFFFAOYSA-N.
| Molecular formula | C11H20O3 |
|---|---|
| Molecular weight | 200.27 g/mol |
| IUPAC name | 2-(2,2,6,6-tetramethyloxan-4-yl)acetic acid |
| InChIKey | OXEUBCJBWRLTDT-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(O1)(C)C)CC(=O)O)C |
Computed by PubChem (NCBI)