CAS 109881-25-6 is the registry number for (-)-6-Aminocarbovir. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2S,5R)-5-(2,6-diaminopurin-9-yl)-2,5-dihydrofuran-2-yl]methanol (CAS 109881-25-6) is a chemical compound with the molecular formula C10H12N6O2 and a molecular weight of 248.24 g/mol. IUPAC name: [(2S,5R)-5-(2,6-diaminopurin-9-yl)-2,5-dihydrofuran-2-yl]methanol. InChIKey: QVRGWJZTKCMSIW-NTSWFWBYSA-N.
| Molecular formula | C10H12N6O2 |
|---|---|
| Molecular weight | 248.24 g/mol |
| IUPAC name | [(2S,5R)-5-(2,6-diaminopurin-9-yl)-2,5-dihydrofuran-2-yl]methanol |
| InChIKey | QVRGWJZTKCMSIW-NTSWFWBYSA-N |
| SMILES | C1=C[C@@H](O[C@@H]1CO)N2C=NC3=C(N=C(N=C32)N)N |
Computed by PubChem (NCBI)