Products 1307025-38-2

CAS 1307025-38-2 is the registry number for 1-{(1,2,3,4)Tetrazolo(1,5-a)pyrazin-5-yl}piperidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidine-4-carboxylic acid (CAS 1307025-38-2) is a chemical compound with the molecular formula C10H12N6O2 and a molecular weight of 248.24 g/mol. IUPAC name: 1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidine-4-carboxylic acid. InChIKey: UMFSGUNQCHMTMK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12N6O2
Molecular weight248.24 g/mol
IUPAC name1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidine-4-carboxylic acid
InChIKeyUMFSGUNQCHMTMK-UHFFFAOYSA-N
SMILESC1CN(CCC1C(=O)O)C2=CN=CC3=NN=NN23

Computed by PubChem (NCBI)