CAS 1099-06-5 appears in our catalog under these names: 4,4'-(Pyridine-2,6-diyl)dibenzoic acid, 98%, 4,4′-(2,6-Pyridinediyl)bis[benzoic acid], 98%, 98%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
4-[6-(4-carboxyphenyl)-2-pyridinyl]benzoic acid (CAS 1099-06-5) is a chemical compound with the molecular formula C19H13NO4 and a molecular weight of 319.3 g/mol. IUPAC name: 4-[6-(4-carboxyphenyl)-2-pyridinyl]benzoic acid. InChIKey: QHYOMFCVEFEYPR-UHFFFAOYSA-N.
| Molecular formula | C19H13NO4 |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | 4-[6-(4-carboxyphenyl)-2-pyridinyl]benzoic acid |
| InChIKey | QHYOMFCVEFEYPR-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C2=CC=C(C=C2)C(=O)O)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)