Products 1800425-09-5
CAS 1800425-09-5 appears in our catalog under these names: 4,4'-(Pyridine-2,5-diyl)dibenzoic acid, 95%, 2,5–Bis(4–carboxyphenyl)pyridine, 4,4'-(Pyridine-2,5-diyl)dibenzoic acid 95%, 4,4'-(Pyridine-2,5-diyl)dibenzoic acid, 98%, 98%, 2,5-Bis(4-carboxyphenyl)pyridine, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 10g, 5g, 1g, 100mg.
4-[6-(4-carboxyphenyl)-3-pyridinyl]benzoic acid (CAS 1800425-09-5) is a chemical compound with the molecular formula C19H13NO4 and a molecular weight of 319.3 g/mol. IUPAC name: 4-[6-(4-carboxyphenyl)-3-pyridinyl]benzoic acid. InChIKey: UOAKBLHTDRACTP-UHFFFAOYSA-N.
| Molecular formula | C19H13NO4 |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | 4-[6-(4-carboxyphenyl)-3-pyridinyl]benzoic acid |
| InChIKey | UOAKBLHTDRACTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(C=C2)C3=CC=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)