CAS 109919-34-8 appears in our catalog under these names: 3,5-Dibromo-2-hydroxy-4-(trifluoromethyl)pyridine, 98%, 3,5-Dibromo-4-(trifluoromethyl)pyridin-2-ol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
3,5-dibromo-4-(trifluoromethyl)-1H-pyridin-2-one (CAS 109919-34-8) is a chemical compound with the molecular formula C6H2Br2F3NO and a molecular weight of 320.89 g/mol. IUPAC name: 3,5-dibromo-4-(trifluoromethyl)-1H-pyridin-2-one. InChIKey: BABYEWFMTLBVED-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2F3NO |
|---|---|
| Molecular weight | 320.89 g/mol |
| IUPAC name | 3,5-dibromo-4-(trifluoromethyl)-1H-pyridin-2-one |
| InChIKey | BABYEWFMTLBVED-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=O)N1)Br)C(F)(F)F)Br |
Computed by PubChem (NCBI)