CAS 741737-00-8 is the registry number for 3,5-Dibromo-6-(trifluoromethyl)pyridin-2-ol, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3,5-dibromo-6-(trifluoromethyl)-1H-pyridin-2-one (CAS 741737-00-8) is a chemical compound with the molecular formula C6H2Br2F3NO and a molecular weight of 320.89 g/mol. IUPAC name: 3,5-dibromo-6-(trifluoromethyl)-1H-pyridin-2-one. InChIKey: ONPVCAKATJHKGR-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2F3NO |
|---|---|
| Molecular weight | 320.89 g/mol |
| IUPAC name | 3,5-dibromo-6-(trifluoromethyl)-1H-pyridin-2-one |
| InChIKey | ONPVCAKATJHKGR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=C1Br)C(F)(F)F)Br |
Computed by PubChem (NCBI)