Products 1185313-66-9
CAS 1185313-66-9 is the registry number for 2–Chloro–3–(trifluoromethyl)–6–(methyl–d3)–pyridine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
2-chloro-6-(trideuteriomethyl)-3-(trifluoromethyl)pyridine (CAS 1185313-66-9) is a chemical compound with the molecular formula C7H5ClF3N and a molecular weight of 198.59 g/mol. IUPAC name: 2-chloro-6-(trideuteriomethyl)-3-(trifluoromethyl)pyridine. InChIKey: DIFCQOVMVHCCHY-FIBGUPNXSA-N.
| Molecular formula | C7H5ClF3N |
|---|---|
| Molecular weight | 198.59 g/mol |
| IUPAC name | 2-chloro-6-(trideuteriomethyl)-3-(trifluoromethyl)pyridine |
| InChIKey | DIFCQOVMVHCCHY-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC(=C(C=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)