CAS 1099621-38-1 appears in our catalog under these names: 1-(4-Bromophenyl)-4,4-dimethylpentan-3-one, 1-(4-Bromophenyl)-4,4-dimethylpentan-3-one, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
1-(4-bromophenyl)-4,4-dimethylpentan-3-one (CAS 1099621-38-1) is a chemical compound with the molecular formula C13H17BrO and a molecular weight of 269.18 g/mol. IUPAC name: 1-(4-bromophenyl)-4,4-dimethylpentan-3-one. InChIKey: UISHQVCAWSFGMJ-UHFFFAOYSA-N.
| Molecular formula | C13H17BrO |
|---|---|
| Molecular weight | 269.18 g/mol |
| IUPAC name | 1-(4-bromophenyl)-4,4-dimethylpentan-3-one |
| InChIKey | UISHQVCAWSFGMJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CCC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)