CAS 73932-65-7 is the registry number for 2-Bromo-1-(2,3,4,5,6-pentamethylphenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-(2,3,4,5,6-pentamethylphenyl)ethanone (CAS 73932-65-7) is a chemical compound with the molecular formula C13H17BrO and a molecular weight of 269.18 g/mol. IUPAC name: 2-bromo-1-(2,3,4,5,6-pentamethylphenyl)ethanone. InChIKey: JHYBKZBHGYMPPU-UHFFFAOYSA-N.
| Molecular formula | C13H17BrO |
|---|---|
| Molecular weight | 269.18 g/mol |
| IUPAC name | 2-bromo-1-(2,3,4,5,6-pentamethylphenyl)ethanone |
| InChIKey | JHYBKZBHGYMPPU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)C(=O)CBr)C)C |
Computed by PubChem (NCBI)