CAS 1099656-48-0 is the registry number for rel-(1R,3r,5S)-6,6-Difluorobicyclo(3.1.0)hexan-3-ol, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 5g, 1g.
(1R,5S)-6,6-difluorobicyclo[3.1.0]hexan-3-ol (CAS 1099656-48-0) is a chemical compound with the molecular formula C6H8F2O and a molecular weight of 134.12 g/mol. IUPAC name: (1R,5S)-6,6-difluorobicyclo[3.1.0]hexan-3-ol. InChIKey: VNYQQAAMRUPWKK-NVGWPGHNSA-N.
| Molecular formula | C6H8F2O |
|---|---|
| Molecular weight | 134.12 g/mol |
| IUPAC name | (1R,5S)-6,6-difluorobicyclo[3.1.0]hexan-3-ol |
| InChIKey | VNYQQAAMRUPWKK-NVGWPGHNSA-N |
| SMILES | C1[C@@H]2[C@@H](C2(F)F)CC1O |
Computed by PubChem (NCBI)