Products 2734860-91-2
CAS 2734860-91-2 is the registry number for Rel-((1R,3R)-2,2-difluoro-3-vinylcyclopropyl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,3R)-3-ethenyl-2,2-difluorocyclopropyl]methanol (CAS 2734860-91-2) is a chemical compound with the molecular formula C6H8F2O and a molecular weight of 134.12 g/mol. IUPAC name: [(1R,3R)-3-ethenyl-2,2-difluorocyclopropyl]methanol. InChIKey: OGZZQJPRKPHCDB-UHNVWZDZSA-N.
| Molecular formula | C6H8F2O |
|---|---|
| Molecular weight | 134.12 g/mol |
| IUPAC name | [(1R,3R)-3-ethenyl-2,2-difluorocyclopropyl]methanol |
| InChIKey | OGZZQJPRKPHCDB-UHNVWZDZSA-N |
| SMILES | C=C[C@@H]1[C@@H](C1(F)F)CO |
Computed by PubChem (NCBI)