Products 11-19-8

CAS 11-19-8 is the registry number for Amlodipine Impurity 32. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-chloro-2-(chloromethyl)benzene (CAS 11-19-8) is a chemical compound with the molecular formula C7H6Cl2 and a molecular weight of 161.03 g/mol. IUPAC name: 1-chloro-2-(chloromethyl)benzene. InChIKey: BASMANVIUSSIIM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6Cl2
Molecular weight161.03 g/mol
IUPAC name1-chloro-2-(chloromethyl)benzene
InChIKeyBASMANVIUSSIIM-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)CCl)Cl

Computed by PubChem (NCBI)