Products 2732862-20-1
CAS 2732862-20-1 appears in our catalog under these names: 1-Chloro-2-(chloromethyl)benzene-3,4,5,6-d4, 2-Chlorobenzyl-3,4,5,6-d4 Chloride, 2-Chlorobenzyl-3,4,5,6-d4 Chloride, 98 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, TRC, CDN. Available pack sizes: 50 mg, 100 mg, 500 mg, 250mg, 500mg, 0,25g, 0,1g.
1-chloro-2-(chloromethyl)-3,4,5,6-tetradeuteriobenzene (CAS 2732862-20-1) is a chemical compound with the molecular formula C7H6Cl2 and a molecular weight of 165.05 g/mol. IUPAC name: 1-chloro-2-(chloromethyl)-3,4,5,6-tetradeuteriobenzene. InChIKey: BASMANVIUSSIIM-RHQRLBAQSA-N.
| Molecular formula | C7H6Cl2 |
|---|---|
| Molecular weight | 165.05 g/mol |
| IUPAC name | 1-chloro-2-(chloromethyl)-3,4,5,6-tetradeuteriobenzene |
| InChIKey | BASMANVIUSSIIM-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])CCl)Cl)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
2-Chlorobenzyl-3,4,5,6-D4 Chloride