CAS 110014-59-0 appears in our catalog under these names: 3,5-Di-tert-butylaniline hydrochloride, 95%, 3,5-Di-tert-butylaniline hydrochloride, 98%, 3,5-Di-tert-butylaniline hydrochloride, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 25g.
3,5-ditert-butylaniline;hydrochloride (CAS 110014-59-0) is a chemical compound with the molecular formula C14H24ClN and a molecular weight of 241.80 g/mol. IUPAC name: 3,5-ditert-butylaniline;hydrochloride. InChIKey: ISAHBRRSWDQIOE-UHFFFAOYSA-N.
| Molecular formula | C14H24ClN |
|---|---|
| Molecular weight | 241.80 g/mol |
| IUPAC name | 3,5-ditert-butylaniline;hydrochloride |
| InChIKey | ISAHBRRSWDQIOE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)N)C(C)(C)C.Cl |
Computed by PubChem (NCBI)