CAS 1803585-84-3 appears in our catalog under these names: 1-(4-tert-butylphenyl)-2-methylpropan-1-amine hydrochloride, 95%, 1-(4-tert-Butylphenyl)-2-methylpropan-1-amine hcl, 95%, 1-(4-tert-Butylphenyl)-2-methylpropan-1-amine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 2,5g.
1-(4-tert-butylphenyl)-2-methylpropan-1-amine;hydrochloride (CAS 1803585-84-3) is a chemical compound with the molecular formula C14H24ClN and a molecular weight of 241.80 g/mol. IUPAC name: 1-(4-tert-butylphenyl)-2-methylpropan-1-amine;hydrochloride. InChIKey: HRXDYHSWZWEVQG-UHFFFAOYSA-N.
| Molecular formula | C14H24ClN |
|---|---|
| Molecular weight | 241.80 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)-2-methylpropan-1-amine;hydrochloride |
| InChIKey | HRXDYHSWZWEVQG-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CC=C(C=C1)C(C)(C)C)N.Cl |
Computed by PubChem (NCBI)