CAS 1100262-14-3 is the registry number for 4–Methoxy–6–methylpyridin–3–ylboronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
(4-methoxy-6-methyl-3-pyridinyl)boronic acid (CAS 1100262-14-3) is a chemical compound with the molecular formula C7H10BNO3 and a molecular weight of 166.97 g/mol. IUPAC name: (4-methoxy-6-methyl-3-pyridinyl)boronic acid. InChIKey: PYSZRJNGKDMOGZ-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO3 |
|---|---|
| Molecular weight | 166.97 g/mol |
| IUPAC name | (4-methoxy-6-methyl-3-pyridinyl)boronic acid |
| InChIKey | PYSZRJNGKDMOGZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(N=C1)C)OC)(O)O |
Computed by PubChem (NCBI)