Products 1100345-72-9
CAS 1100345-72-9 is the registry number for 5-Bromo-2,3,4,9-tetrahydro-1H-carbazol-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-bromo-2,3,4,9-tetrahydrocarbazol-1-one (CAS 1100345-72-9) is a chemical compound with the molecular formula C12H10BrNO and a molecular weight of 264.12 g/mol. IUPAC name: 5-bromo-2,3,4,9-tetrahydrocarbazol-1-one. InChIKey: DPJQYEHKRGAGSN-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO |
|---|---|
| Molecular weight | 264.12 g/mol |
| IUPAC name | 5-bromo-2,3,4,9-tetrahydrocarbazol-1-one |
| InChIKey | DPJQYEHKRGAGSN-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)NC3=C2C(=CC=C3)Br |
Computed by PubChem (NCBI)