Products 110062-45-8

CAS 110062-45-8 is the registry number for 5-Mercapto-4-(2-phenylethyl)-4h-1,2,4-triazol-3-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

4-(2-phenylethyl)-5-sulfanylidene-1,2,4-triazolidin-3-one (CAS 110062-45-8) is a chemical compound with the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. IUPAC name: 4-(2-phenylethyl)-5-sulfanylidene-1,2,4-triazolidin-3-one. InChIKey: KJXNUVNCFDNFIH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11N3OS
Molecular weight221.28 g/mol
IUPAC name4-(2-phenylethyl)-5-sulfanylidene-1,2,4-triazolidin-3-one
InChIKeyKJXNUVNCFDNFIH-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCN2C(=O)NNC2=S

Computed by PubChem (NCBI)